C21H22FNO3 — CID 7604763
[2-[(2,4-dimethylphenyl)methyl-methylamino]-2-oxoethyl] (E)-3-(4-fluorophenyl)prop-2-enoate (PubChem CID 7604763) has the molecular formula C21H22FNO3 and a molecular weight of 355.41 g/mol. Its IUPAC name is [2-[(2,4-dimethylphenyl)methyl-methylamino]-2-oxoethyl] (E)-3-(4-fluorophenyl)prop-2-enoate.
| Compound Name | [2-[(2,4-dimethylphenyl)methyl-methylamino]-2-oxoethyl] (E)-3-(4-fluorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 7604763 |
| Molecular Formula | C21H22FNO3 |
| Molecular Weight | 355.41 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | [2-[(2,4-dimethylphenyl)methyl-methylamino]-2-oxoethyl] (E)-3-(4-fluorophenyl)prop-2-enoate |
| SMILES | Cc1ccc(CN(C)C(=O)COC(=O)/C=C/c2ccc(F)cc2)c(C)c1 |
| InChI | InChI=1S/C21H22FNO3/c1-15-4-8-18(16(2)12-15)13-23(3)20(24)14-26-21(25)11-7-17-5-9-19(22)10-6-17/h4-12H,13-14H2,1-3H3/b11-7+ |
| InChIKey | LJDMQZAJSAIXNG-YRNVUSSQSA-N |
| XLogP | 3.66 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.41 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|