C19H16Cl2FNO3 — CID 9333408
[2-[(3,4-dichlorophenyl)methyl-methylamino]-2-oxoethyl] (E)-3-(4-fluorophenyl)prop-2-enoate (PubChem CID 9333408) has the molecular formula C19H16Cl2FNO3 and a molecular weight of 396.25 g/mol. Its IUPAC name is [2-[(3,4-dichlorophenyl)methyl-methylamino]-2-oxoethyl] (E)-3-(4-fluorophenyl)prop-2-enoate.
| Compound Name | [2-[(3,4-dichlorophenyl)methyl-methylamino]-2-oxoethyl] (E)-3-(4-fluorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 9333408 |
| Molecular Formula | C19H16Cl2FNO3 |
| Molecular Weight | 396.25 g/mol |
| Exact Mass | 395.05 |
| IUPAC Name | [2-[(3,4-dichlorophenyl)methyl-methylamino]-2-oxoethyl] (E)-3-(4-fluorophenyl)prop-2-enoate |
| SMILES | CN(Cc1ccc(Cl)c(Cl)c1)C(=O)COC(=O)/C=C/c1ccc(F)cc1 |
| InChI | InChI=1S/C19H16Cl2FNO3/c1-23(11-14-4-8-16(20)17(21)10-14)18(24)12-26-19(25)9-5-13-2-6-15(22)7-3-13/h2-10H,11-12H2,1H3/b9-5+ |
| InChIKey | ADLNAYFRZOQJLT-WEVVVXLNSA-N |
| XLogP | 4.35 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.25 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|