C25H34N2O4 — CID 7611534
N-[(2S)-1-(5-tert-butyl-2-methoxyanilino)-3-methyl-1-oxobutan-2-yl]-2-ethoxybenzamide (PubChem CID 7611534) has the molecular formula C25H34N2O4 and a molecular weight of 426.56 g/mol. Its IUPAC name is N-[(2S)-1-(5-tert-butyl-2-methoxyanilino)-3-methyl-1-oxobutan-2-yl]-2-ethoxybenzamide.
| Compound Name | N-[(2S)-1-(5-tert-butyl-2-methoxyanilino)-3-methyl-1-oxobutan-2-yl]-2-ethoxybenzamide |
|---|---|
| PubChem CID | 7611534 |
| Molecular Formula | C25H34N2O4 |
| Molecular Weight | 426.56 g/mol |
| Exact Mass | 426.25 |
| IUPAC Name | N-[(2S)-1-(5-tert-butyl-2-methoxyanilino)-3-methyl-1-oxobutan-2-yl]-2-ethoxybenzamide |
| SMILES | CCOc1ccccc1C(=O)N[C@H](C(=O)Nc1cc(C(C)(C)C)ccc1OC)C(C)C |
| InChI | InChI=1S/C25H34N2O4/c1-8-31-20-12-10-9-11-18(20)23(28)27-22(16(2)3)24(29)26-19-15-17(25(4,5)6)13-14-21(19)30-7/h9-16,22H,8H2,1-7H3,(H,26,29)(H,27,28)/t22-/m0/s1 |
| InChIKey | OGWNWSAGJFPDOB-QFIPXVFZSA-N |
| XLogP | 4.78 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.56 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |