C21H29N3O3S — CID 7615021
1-[2-(2-ethoxyphenyl)imino-4-methyl-3-(3-morpholin-4-ylpropyl)-1,3-thiazol-5-yl]ethanone (PubChem CID 7615021) has the molecular formula C21H29N3O3S and a molecular weight of 403.55 g/mol. Its IUPAC name is 1-[2-(2-ethoxyphenyl)imino-4-methyl-3-(3-morpholin-4-ylpropyl)-1,3-thiazol-5-yl]ethanone.
| Compound Name | 1-[2-(2-ethoxyphenyl)imino-4-methyl-3-(3-morpholin-4-ylpropyl)-1,3-thiazol-5-yl]ethanone |
|---|---|
| PubChem CID | 7615021 |
| Molecular Formula | C21H29N3O3S |
| Molecular Weight | 403.55 g/mol |
| Exact Mass | 403.19 |
| IUPAC Name | 1-[2-(2-ethoxyphenyl)imino-4-methyl-3-(3-morpholin-4-ylpropyl)-1,3-thiazol-5-yl]ethanone |
| SMILES | CCOc1ccccc1/N=c1\sc(C(C)=O)c(C)n1CCCN1CCOCC1 |
| InChI | InChI=1S/C21H29N3O3S/c1-4-27-19-9-6-5-8-18(19)22-21-24(16(2)20(28-21)17(3)25)11-7-10-23-12-14-26-15-13-23/h5-6,8-9H,4,7,10-15H2,1-3H3/b22-21- |
| InChIKey | ZMSOXTJIVGFCLF-DQRAZIAOSA-N |
| XLogP | 3.41 |
| TPSA | 56.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.55 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|