C20H23FN2O6 — CID 7616451
ethyl 5-[2-(2,2-dimethoxyethylamino)-2-oxoacetyl]-4-(4-fluorophenyl)-2-methyl-1H-pyrrole-3-carboxylate (PubChem CID 7616451) has the molecular formula C20H23FN2O6 and a molecular weight of 406.41 g/mol. Its IUPAC name is ethyl 5-[2-(2,2-dimethoxyethylamino)-2-oxoacetyl]-4-(4-fluorophenyl)-2-methyl-1H-pyrrole-3-carboxylate.
| Compound Name | ethyl 5-[2-(2,2-dimethoxyethylamino)-2-oxoacetyl]-4-(4-fluorophenyl)-2-methyl-1H-pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 7616451 |
| Molecular Formula | C20H23FN2O6 |
| Molecular Weight | 406.41 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | ethyl 5-[2-(2,2-dimethoxyethylamino)-2-oxoacetyl]-4-(4-fluorophenyl)-2-methyl-1H-pyrrole-3-carboxylate |
| SMILES | CCOC(=O)c1c(C)[nH]c(C(=O)C(=O)NCC(OC)OC)c1-c1ccc(F)cc1 |
| InChI | InChI=1S/C20H23FN2O6/c1-5-29-20(26)15-11(2)23-17(16(15)12-6-8-13(21)9-7-12)18(24)19(25)22-10-14(27-3)28-4/h6-9,14,23H,5,10H2,1-4H3,(H,22,25) |
| InChIKey | BGIBKWYTKCTNQG-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 106.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.41 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|