C24H23FN2O4 — CID 7616471
ethyl 4-(4-fluorophenyl)-2-methyl-5-[2-oxo-2-[[(1R)-1-phenylethyl]amino]acetyl]-1H-pyrrole-3-carboxylate (PubChem CID 7616471) has the molecular formula C24H23FN2O4 and a molecular weight of 422.46 g/mol. Its IUPAC name is ethyl 4-(4-fluorophenyl)-2-methyl-5-[2-oxo-2-[[(1R)-1-phenylethyl]amino]acetyl]-1H-pyrrole-3-carboxylate.
| Compound Name | ethyl 4-(4-fluorophenyl)-2-methyl-5-[2-oxo-2-[[(1R)-1-phenylethyl]amino]acetyl]-1H-pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 7616471 |
| Molecular Formula | C24H23FN2O4 |
| Molecular Weight | 422.46 g/mol |
| Exact Mass | 422.16 |
| IUPAC Name | ethyl 4-(4-fluorophenyl)-2-methyl-5-[2-oxo-2-[[(1R)-1-phenylethyl]amino]acetyl]-1H-pyrrole-3-carboxylate |
| SMILES | CCOC(=O)c1c(C)[nH]c(C(=O)C(=O)N[C@H](C)c2ccccc2)c1-c1ccc(F)cc1 |
| InChI | InChI=1S/C24H23FN2O4/c1-4-31-24(30)19-15(3)26-21(20(19)17-10-12-18(25)13-11-17)22(28)23(29)27-14(2)16-8-6-5-7-9-16/h5-14,26H,4H2,1-3H3,(H,27,29)/t14-/m1/s1 |
| InChIKey | AGEKXBUMUONOHO-CQSZACIVSA-N |
| XLogP | 4.37 |
| TPSA | 88.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.46 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|