C22H19FN2O4 — CID 7616228
ethyl 5-[2-(3-fluoroanilino)-2-oxoacetyl]-2-methyl-4-phenyl-1H-pyrrole-3-carboxylate (PubChem CID 7616228) has the molecular formula C22H19FN2O4 and a molecular weight of 394.40 g/mol. Its IUPAC name is ethyl 5-[2-(3-fluoroanilino)-2-oxoacetyl]-2-methyl-4-phenyl-1H-pyrrole-3-carboxylate.
| Compound Name | ethyl 5-[2-(3-fluoroanilino)-2-oxoacetyl]-2-methyl-4-phenyl-1H-pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 7616228 |
| Molecular Formula | C22H19FN2O4 |
| Molecular Weight | 394.40 g/mol |
| Exact Mass | 394.13 |
| IUPAC Name | ethyl 5-[2-(3-fluoroanilino)-2-oxoacetyl]-2-methyl-4-phenyl-1H-pyrrole-3-carboxylate |
| SMILES | CCOC(=O)c1c(C)[nH]c(C(=O)C(=O)Nc2cccc(F)c2)c1-c1ccccc1 |
| InChI | InChI=1S/C22H19FN2O4/c1-3-29-22(28)17-13(2)24-19(18(17)14-8-5-4-6-9-14)20(26)21(27)25-16-11-7-10-15(23)12-16/h4-12,24H,3H2,1-2H3,(H,25,27) |
| InChIKey | ZWGCHDGKMJHXHS-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 88.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.40 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|