C15H17NO5 — CID 761879
3-[[(1R,2R)-2-carboxycyclohexanecarbonyl]amino]benzoic acid (PubChem CID 761879) has the molecular formula C15H17NO5 and a molecular weight of 291.30 g/mol. Its IUPAC name is 3-[[(1R,2R)-2-carboxycyclohexanecarbonyl]amino]benzoic acid.
| Compound Name | 3-[[(1R,2R)-2-carboxycyclohexanecarbonyl]amino]benzoic acid |
|---|---|
| PubChem CID | 761879 |
| Molecular Formula | C15H17NO5 |
| Molecular Weight | 291.30 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | 3-[[(1R,2R)-2-carboxycyclohexanecarbonyl]amino]benzoic acid |
| SMILES | O=C(O)c1cccc(NC(=O)[C@@H]2CCCC[C@H]2C(=O)O)c1 |
| InChI | InChI=1S/C15H17NO5/c17-13(11-6-1-2-7-12(11)15(20)21)16-10-5-3-4-9(8-10)14(18)19/h3-5,8,11-12H,1-2,6-7H2,(H,16,17)(H,18,19)(H,20,21)/t11-,12-/m1/s1 |
| InChIKey | LHZDDILKQAJPCN-VXGBXAGGSA-N |
| XLogP | 2.21 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.30 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |