3-[[(1R,2R)-2-carboxycyclohexanecarbonyl]amino]benzoic acid

C15H17NO5 — CID 761879

IUPAC3-[[(1R,2R)-2-carboxycyclohexanecarbonyl]amino]benzoic acid
SMILESO=C(O)c1cccc(NC(=O)[C@@H]2CCCC[C@H]2C(=O)O)c1
InChIInChI=1S/C15H17NO5/c17-13(11-6-1-2-7-12(11)15(20)21)16-10-5-3-4-9(8-10)14(18)19/h3-5,8,11-12H,1-2,6-7H2,(H,16,17)(H,18,19)(H,20,21)/t11-,12-/m1/s1
InChIKeyLHZDDILKQAJPCN-VXGBXAGGSA-N
MW291.30 g/mol
LogP2.21
Rot. Bonds4

About 3-[[(1R,2R)-2-carboxycyclohexanecarbonyl]amino]benzoic acid

3-[[(1R,2R)-2-carboxycyclohexanecarbonyl]amino]benzoic acid (PubChem CID 761879) has the molecular formula C15H17NO5 and a molecular weight of 291.30 g/mol. Its IUPAC name is 3-[[(1R,2R)-2-carboxycyclohexanecarbonyl]amino]benzoic acid.

Molecular Properties

Compound Name3-[[(1R,2R)-2-carboxycyclohexanecarbonyl]amino]benzoic acid
PubChem CID761879
Molecular FormulaC15H17NO5
Molecular Weight291.30 g/mol
Exact Mass291.11
IUPAC Name3-[[(1R,2R)-2-carboxycyclohexanecarbonyl]amino]benzoic acid
SMILESO=C(O)c1cccc(NC(=O)[C@@H]2CCCC[C@H]2C(=O)O)c1
InChIInChI=1S/C15H17NO5/c17-13(11-6-1-2-7-12(11)15(20)21)16-10-5-3-4-9(8-10)14(18)19/h3-5,8,11-12H,1-2,6-7H2,(H,16,17)(H,18,19)(H,20,21)/t11-,12-/m1/s1
InChIKeyLHZDDILKQAJPCN-VXGBXAGGSA-N
XLogP2.21
TPSA103.70 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500291.30
LogP ≤ 52.21
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Analyze 3-[[(1R,2R)-2-carboxycyclohexanecarbonyl]amino]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[[(1R,2R)-2-carboxycyclohexanecarbonyl]amino]benzoic acid?
The IUPAC name of 3-[[(1R,2R)-2-carboxycyclohexanecarbonyl]amino]benzoic acid (CID 761879) is 3-[[(1R,2R)-2-carboxycyclohexanecarbonyl]amino]benzoic acid.
What is the SMILES notation for 3-[[(1R,2R)-2-carboxycyclohexanecarbonyl]amino]benzoic acid?
The canonical SMILES for 3-[[(1R,2R)-2-carboxycyclohexanecarbonyl]amino]benzoic acid is O=C(O)c1cccc(NC(=O)[C@@H]2CCCC[C@H]2C(=O)O)c1.
What is the InChIKey of 3-[[(1R,2R)-2-carboxycyclohexanecarbonyl]amino]benzoic acid?
The InChIKey is LHZDDILKQAJPCN-VXGBXAGGSA-N. The full InChI is InChI=1S/C15H17NO5/c17-13(11-6-1-2-7-12(11)15(20)21)16-10-5-3-4-9(8-10)14(18)19/h3-5,8,11-12H,1-2,6-7H2,(H,16,17)(H,18,19)(H,20,21)/t11-,12-/m1/s1.
What are the key properties of 3-[[(1R,2R)-2-carboxycyclohexanecarbonyl]amino]benzoic acid?
3-[[(1R,2R)-2-carboxycyclohexanecarbonyl]amino]benzoic acid has a molecular weight of 291.30 g/mol, XLogP of 2.21, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[(1R,2R)-2-carboxycyclohexanecarbonyl]amino]benzoic acid is sourced from PubChem (CID 761879), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).