C16H11FN4O4 — CID 7619564
N-(4-fluoro-3-nitrophenyl)-1-methyl-2-oxo-1,8-naphthyridine-3-carboxamide (PubChem CID 7619564) has the molecular formula C16H11FN4O4 and a molecular weight of 342.29 g/mol. Its IUPAC name is N-(4-fluoro-3-nitrophenyl)-1-methyl-2-oxo-1,8-naphthyridine-3-carboxamide.
| Compound Name | N-(4-fluoro-3-nitrophenyl)-1-methyl-2-oxo-1,8-naphthyridine-3-carboxamide |
|---|---|
| PubChem CID | 7619564 |
| Molecular Formula | C16H11FN4O4 |
| Molecular Weight | 342.29 g/mol |
| Exact Mass | 342.08 |
| IUPAC Name | N-(4-fluoro-3-nitrophenyl)-1-methyl-2-oxo-1,8-naphthyridine-3-carboxamide |
| SMILES | Cn1c(=O)c(C(=O)Nc2ccc(F)c([N+](=O)[O-])c2)cc2cccnc21 |
| InChI | InChI=1S/C16H11FN4O4/c1-20-14-9(3-2-6-18-14)7-11(16(20)23)15(22)19-10-4-5-12(17)13(8-10)21(24)25/h2-8H,1H3,(H,19,22) |
| InChIKey | NGULISSVUSLVBQ-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 107.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.29 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|