C16H19N3O2 — CID 7619782
N-cyclopentyl-1-ethyl-2-oxo-1,8-naphthyridine-3-carboxamide (PubChem CID 7619782) has the molecular formula C16H19N3O2 and a molecular weight of 285.35 g/mol. Its IUPAC name is N-cyclopentyl-1-ethyl-2-oxo-1,8-naphthyridine-3-carboxamide.
| Compound Name | N-cyclopentyl-1-ethyl-2-oxo-1,8-naphthyridine-3-carboxamide |
|---|---|
| PubChem CID | 7619782 |
| Molecular Formula | C16H19N3O2 |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | N-cyclopentyl-1-ethyl-2-oxo-1,8-naphthyridine-3-carboxamide |
| SMILES | CCn1c(=O)c(C(=O)NC2CCCC2)cc2cccnc21 |
| InChI | InChI=1S/C16H19N3O2/c1-2-19-14-11(6-5-9-17-14)10-13(16(19)21)15(20)18-12-7-3-4-8-12/h5-6,9-10,12H,2-4,7-8H2,1H3,(H,18,20) |
| InChIKey | UQKGGXPQDOUVHA-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |