About 2-[(1-ethyl-2-oxo-1,8-naphthyridine-3-carbonyl)amino]benzenethiolate
2-[(1-ethyl-2-oxo-1,8-naphthyridine-3-carbonyl)amino]benzenethiolate (PubChem CID 135782783) has the molecular formula C17H14N3O2S-
and a molecular weight of 324.39 g/mol. Its IUPAC name is 2-[(1-ethyl-2-oxo-1,8-naphthyridine-3-carbonyl)amino]benzenethiolate.
Molecular Properties
| Compound Name | 2-[(1-ethyl-2-oxo-1,8-naphthyridine-3-carbonyl)amino]benzenethiolate |
| PubChem CID | 135782783 |
| Molecular Formula | C17H14N3O2S- |
| Molecular Weight | 324.39 g/mol |
| Exact Mass | 324.08 |
| IUPAC Name | 2-[(1-ethyl-2-oxo-1,8-naphthyridine-3-carbonyl)amino]benzenethiolate |
| SMILES | CCn1c(=O)c(C(=O)Nc2ccccc2[S-])cc2cccnc21 |
| InChI | InChI=1S/C17H15N3O2S/c1-2-20-15-11(6-5-9-18-15)10-12(17(20)22)16(21)19-13-7-3-4-8-14(13)23/h3-10,23H,2H2,1H3,(H,19,21)/p-1 |
| InChIKey | AGBHSXAHLPCXHT-UHFFFAOYSA-M |
| XLogP | 2.57 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.39 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[(1-ethyl-2-oxo-1,8-naphthyridine-3-carbonyl)amino]benzenethiolate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1-ethyl-2-oxo-1,8-naphthyridine-3-carbonyl)amino]benzenethiolate?
The IUPAC name of 2-[(1-ethyl-2-oxo-1,8-naphthyridine-3-carbonyl)amino]benzenethiolate (CID 135782783) is 2-[(1-ethyl-2-oxo-1,8-naphthyridine-3-carbonyl)amino]benzenethiolate.
What is the SMILES notation for 2-[(1-ethyl-2-oxo-1,8-naphthyridine-3-carbonyl)amino]benzenethiolate?
The canonical SMILES for 2-[(1-ethyl-2-oxo-1,8-naphthyridine-3-carbonyl)amino]benzenethiolate is CCn1c(=O)c(C(=O)Nc2ccccc2[S-])cc2cccnc21.
What is the InChIKey of 2-[(1-ethyl-2-oxo-1,8-naphthyridine-3-carbonyl)amino]benzenethiolate?
The InChIKey is AGBHSXAHLPCXHT-UHFFFAOYSA-M. The full InChI is InChI=1S/C17H15N3O2S/c1-2-20-15-11(6-5-9-18-15)10-12(17(20)22)16(21)19-13-7-3-4-8-14(13)23/h3-10,23H,2H2,1H3,(H,19,21)/p-1.
What are the key properties of 2-[(1-ethyl-2-oxo-1,8-naphthyridine-3-carbonyl)amino]benzenethiolate?
2-[(1-ethyl-2-oxo-1,8-naphthyridine-3-carbonyl)amino]benzenethiolate has a molecular weight of 324.39 g/mol, XLogP of 2.57, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1-ethyl-2-oxo-1,8-naphthyridine-3-carbonyl)amino]benzenethiolate is sourced from PubChem (CID 135782783), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).