C17H14N3O2S- — CID 135782783
2-[(1-ethyl-2-oxo-1,8-naphthyridine-3-carbonyl)amino]benzenethiolate (PubChem CID 135782783) has the molecular formula C17H14N3O2S- and a molecular weight of 324.39 g/mol. Its IUPAC name is 2-[(1-ethyl-2-oxo-1,8-naphthyridine-3-carbonyl)amino]benzenethiolate.
| Compound Name | 2-[(1-ethyl-2-oxo-1,8-naphthyridine-3-carbonyl)amino]benzenethiolate |
|---|---|
| PubChem CID | 135782783 |
| Molecular Formula | C17H14N3O2S- |
| Molecular Weight | 324.39 g/mol |
| Exact Mass | 324.08 |
| IUPAC Name | 2-[(1-ethyl-2-oxo-1,8-naphthyridine-3-carbonyl)amino]benzenethiolate |
| SMILES | CCn1c(=O)c(C(=O)Nc2ccccc2[S-])cc2cccnc21 |
| InChI | InChI=1S/C17H15N3O2S/c1-2-20-15-11(6-5-9-18-15)10-12(17(20)22)16(21)19-13-7-3-4-8-14(13)23/h3-10,23H,2H2,1H3,(H,19,21)/p-1 |
| InChIKey | AGBHSXAHLPCXHT-UHFFFAOYSA-M |
| XLogP | 2.57 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.39 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|