C16H13N7O2 — CID 7620011
1-ethyl-2-oxo-N-(7H-purin-6-yl)-1,8-naphthyridine-3-carboxamide (PubChem CID 7620011) has the molecular formula C16H13N7O2 and a molecular weight of 335.33 g/mol. Its IUPAC name is 1-ethyl-2-oxo-N-(7H-purin-6-yl)-1,8-naphthyridine-3-carboxamide.
| Compound Name | 1-ethyl-2-oxo-N-(7H-purin-6-yl)-1,8-naphthyridine-3-carboxamide |
|---|---|
| PubChem CID | 7620011 |
| Molecular Formula | C16H13N7O2 |
| Molecular Weight | 335.33 g/mol |
| Exact Mass | 335.11 |
| IUPAC Name | 1-ethyl-2-oxo-N-(7H-purin-6-yl)-1,8-naphthyridine-3-carboxamide |
| SMILES | CCn1c(=O)c(C(=O)Nc2ncnc3nc[nH]c23)cc2cccnc21 |
| InChI | InChI=1S/C16H13N7O2/c1-2-23-14-9(4-3-5-17-14)6-10(16(23)25)15(24)22-13-11-12(19-7-18-11)20-8-21-13/h3-8H,2H2,1H3,(H2,18,19,20,21,22,24) |
| InChIKey | FQZCKQAJGJIQHX-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 118.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.33 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |