C21H15N7O2 — CID 7620340
1-benzyl-2-oxo-N-(7H-purin-6-yl)-1,8-naphthyridine-3-carboxamide (PubChem CID 7620340) has the molecular formula C21H15N7O2 and a molecular weight of 397.40 g/mol. Its IUPAC name is 1-benzyl-2-oxo-N-(7H-purin-6-yl)-1,8-naphthyridine-3-carboxamide.
| Compound Name | 1-benzyl-2-oxo-N-(7H-purin-6-yl)-1,8-naphthyridine-3-carboxamide |
|---|---|
| PubChem CID | 7620340 |
| Molecular Formula | C21H15N7O2 |
| Molecular Weight | 397.40 g/mol |
| Exact Mass | 397.13 |
| IUPAC Name | 1-benzyl-2-oxo-N-(7H-purin-6-yl)-1,8-naphthyridine-3-carboxamide |
| SMILES | O=C(Nc1ncnc2nc[nH]c12)c1cc2cccnc2n(Cc2ccccc2)c1=O |
| InChI | InChI=1S/C21H15N7O2/c29-20(27-18-16-17(24-11-23-16)25-12-26-18)15-9-14-7-4-8-22-19(14)28(21(15)30)10-13-5-2-1-3-6-13/h1-9,11-12H,10H2,(H2,23,24,25,26,27,29) |
| InChIKey | UOIUQXUKNDEOSJ-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 118.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.40 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |