C25H33N4O2+ — CID 7620129
[(4S)-4-[(1-benzyl-2-oxo-1,8-naphthyridine-3-carbonyl)amino]pentyl]-diethylazanium (PubChem CID 7620129) has the molecular formula C25H33N4O2+ and a molecular weight of 421.57 g/mol. Its IUPAC name is [(4S)-4-[(1-benzyl-2-oxo-1,8-naphthyridine-3-carbonyl)amino]pentyl]-diethylazanium.
| Compound Name | [(4S)-4-[(1-benzyl-2-oxo-1,8-naphthyridine-3-carbonyl)amino]pentyl]-diethylazanium |
|---|---|
| PubChem CID | 7620129 |
| Molecular Formula | C25H33N4O2+ |
| Molecular Weight | 421.57 g/mol |
| Exact Mass | 421.26 |
| IUPAC Name | [(4S)-4-[(1-benzyl-2-oxo-1,8-naphthyridine-3-carbonyl)amino]pentyl]-diethylazanium |
| SMILES | CC[NH+](CC)CCC[C@H](C)NC(=O)c1cc2cccnc2n(Cc2ccccc2)c1=O |
| InChI | InChI=1S/C25H32N4O2/c1-4-28(5-2)16-10-11-19(3)27-24(30)22-17-21-14-9-15-26-23(21)29(25(22)31)18-20-12-7-6-8-13-20/h6-9,12-15,17,19H,4-5,10-11,16,18H2,1-3H3,(H,27,30)/p+1/t19-/m0/s1 |
| InChIKey | VJFQHLMHPYPDGT-IBGZPJMESA-O |
| XLogP | 2.27 |
| TPSA | 68.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.57 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |