C16H19N2O4S- — CID 7622063
(2S)-2-[4-(hydroxymethyl)-1-[(4-methoxyphenyl)methyl]imidazol-2-yl]sulfanylbutanoate (PubChem CID 7622063) has the molecular formula C16H19N2O4S- and a molecular weight of 335.41 g/mol. Its IUPAC name is (2S)-2-[4-(hydroxymethyl)-1-[(4-methoxyphenyl)methyl]imidazol-2-yl]sulfanylbutanoate.
| Compound Name | (2S)-2-[4-(hydroxymethyl)-1-[(4-methoxyphenyl)methyl]imidazol-2-yl]sulfanylbutanoate |
|---|---|
| PubChem CID | 7622063 |
| Molecular Formula | C16H19N2O4S- |
| Molecular Weight | 335.41 g/mol |
| Exact Mass | 335.11 |
| IUPAC Name | (2S)-2-[4-(hydroxymethyl)-1-[(4-methoxyphenyl)methyl]imidazol-2-yl]sulfanylbutanoate |
| SMILES | CC[C@H](Sc1nc(CO)cn1Cc1ccc(OC)cc1)C(=O)[O-] |
| InChI | InChI=1S/C16H20N2O4S/c1-3-14(15(20)21)23-16-17-12(10-19)9-18(16)8-11-4-6-13(22-2)7-5-11/h4-7,9,14,19H,3,8,10H2,1-2H3,(H,20,21)/p-1/t14-/m0/s1 |
| InChIKey | KUQGVPWUGWHSMN-AWEZNQCLSA-M |
| XLogP | 1.05 |
| TPSA | 87.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.41 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |