C16H19N2O3S- — CID 7621451
(2S)-2-[4-(hydroxymethyl)-1-[(4-methylphenyl)methyl]imidazol-2-yl]sulfanylbutanoate (PubChem CID 7621451) has the molecular formula C16H19N2O3S- and a molecular weight of 319.41 g/mol. Its IUPAC name is (2S)-2-[4-(hydroxymethyl)-1-[(4-methylphenyl)methyl]imidazol-2-yl]sulfanylbutanoate.
| Compound Name | (2S)-2-[4-(hydroxymethyl)-1-[(4-methylphenyl)methyl]imidazol-2-yl]sulfanylbutanoate |
|---|---|
| PubChem CID | 7621451 |
| Molecular Formula | C16H19N2O3S- |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | (2S)-2-[4-(hydroxymethyl)-1-[(4-methylphenyl)methyl]imidazol-2-yl]sulfanylbutanoate |
| SMILES | CC[C@H](Sc1nc(CO)cn1Cc1ccc(C)cc1)C(=O)[O-] |
| InChI | InChI=1S/C16H20N2O3S/c1-3-14(15(20)21)22-16-17-13(10-19)9-18(16)8-12-6-4-11(2)5-7-12/h4-7,9,14,19H,3,8,10H2,1-2H3,(H,20,21)/p-1/t14-/m0/s1 |
| InChIKey | HJDCGYSOEAEKEO-AWEZNQCLSA-M |
| XLogP | 1.35 |
| TPSA | 78.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |