C15H16ClN2O3S- — CID 7622210
(2S)-2-[1-[(4-chlorophenyl)methyl]-4-(hydroxymethyl)imidazol-2-yl]sulfanylbutanoate (PubChem CID 7622210) has the molecular formula C15H16ClN2O3S- and a molecular weight of 339.82 g/mol. Its IUPAC name is (2S)-2-[1-[(4-chlorophenyl)methyl]-4-(hydroxymethyl)imidazol-2-yl]sulfanylbutanoate.
| Compound Name | (2S)-2-[1-[(4-chlorophenyl)methyl]-4-(hydroxymethyl)imidazol-2-yl]sulfanylbutanoate |
|---|---|
| PubChem CID | 7622210 |
| Molecular Formula | C15H16ClN2O3S- |
| Molecular Weight | 339.82 g/mol |
| Exact Mass | 339.06 |
| IUPAC Name | (2S)-2-[1-[(4-chlorophenyl)methyl]-4-(hydroxymethyl)imidazol-2-yl]sulfanylbutanoate |
| SMILES | CC[C@H](Sc1nc(CO)cn1Cc1ccc(Cl)cc1)C(=O)[O-] |
| InChI | InChI=1S/C15H17ClN2O3S/c1-2-13(14(20)21)22-15-17-12(9-19)8-18(15)7-10-3-5-11(16)6-4-10/h3-6,8,13,19H,2,7,9H2,1H3,(H,20,21)/p-1/t13-/m0/s1 |
| InChIKey | XOECFCGTQCVPRR-ZDUSSCGKSA-M |
| XLogP | 1.70 |
| TPSA | 78.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.82 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |