C19H20N2OS — CID 7621670
[1-benzyl-2-[(1S)-1-phenylethyl]sulfanylimidazol-4-yl]methanol (PubChem CID 7621670) has the molecular formula C19H20N2OS and a molecular weight of 324.45 g/mol. Its IUPAC name is [1-benzyl-2-[(1S)-1-phenylethyl]sulfanylimidazol-4-yl]methanol.
| Compound Name | [1-benzyl-2-[(1S)-1-phenylethyl]sulfanylimidazol-4-yl]methanol |
|---|---|
| PubChem CID | 7621670 |
| Molecular Formula | C19H20N2OS |
| Molecular Weight | 324.45 g/mol |
| Exact Mass | 324.13 |
| IUPAC Name | [1-benzyl-2-[(1S)-1-phenylethyl]sulfanylimidazol-4-yl]methanol |
| SMILES | C[C@H](Sc1nc(CO)cn1Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H20N2OS/c1-15(17-10-6-3-7-11-17)23-19-20-18(14-22)13-21(19)12-16-8-4-2-5-9-16/h2-11,13,15,22H,12,14H2,1H3/t15-/m0/s1 |
| InChIKey | QJKHFMASDYLWGM-HNNXBMFYSA-N |
| XLogP | 4.28 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.45 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |