C12H10F4N2 — CID 762942
3-(4-methylphenyl)-5-(1,1,2,2-tetrafluoroethyl)-1H-pyrazole (PubChem CID 762942) has the molecular formula C12H10F4N2 and a molecular weight of 258.22 g/mol. Its IUPAC name is 3-(4-methylphenyl)-5-(1,1,2,2-tetrafluoroethyl)-1H-pyrazole.
| Compound Name | 3-(4-methylphenyl)-5-(1,1,2,2-tetrafluoroethyl)-1H-pyrazole |
|---|---|
| PubChem CID | 762942 |
| Molecular Formula | C12H10F4N2 |
| Molecular Weight | 258.22 g/mol |
| Exact Mass | 258.08 |
| IUPAC Name | 3-(4-methylphenyl)-5-(1,1,2,2-tetrafluoroethyl)-1H-pyrazole |
| SMILES | Cc1ccc(-c2cc(C(F)(F)C(F)F)[nH]n2)cc1 |
| InChI | InChI=1S/C12H10F4N2/c1-7-2-4-8(5-3-7)9-6-10(18-17-9)12(15,16)11(13)14/h2-6,11H,1H3,(H,17,18) |
| InChIKey | XWRCZOUPXBKKHA-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.22 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|