C15H11F2NS — CID 76319736
2-(2,6-Difluorophenyl)-5-phenyl-4,5-dihydro-1,3-thiazole (PubChem CID 76319736) has the molecular formula C15H11F2NS and a molecular weight of 275.32 g/mol. Its IUPAC name is 2-(2,6-difluorophenyl)-5-phenyl-4,5-dihydro-1,3-thiazole.
| Compound Name | 2-(2,6-Difluorophenyl)-5-phenyl-4,5-dihydro-1,3-thiazole |
|---|---|
| PubChem CID | 76319736 |
| Molecular Formula | C15H11F2NS |
| Molecular Weight | 275.32 g/mol |
| Exact Mass | 275.06 |
| IUPAC Name | 2-(2,6-difluorophenyl)-5-phenyl-4,5-dihydro-1,3-thiazole |
| SMILES | C1C(SC(=N1)C2=C(C=CC=C2F)F)C3=CC=CC=C3 |
| InChI | InChI=1S/C15H11F2NS/c16-11-7-4-8-12(17)14(11)15-18-9-13(19-15)10-5-2-1-3-6-10/h1-8,13H,9H2 |
| InChIKey | VWMYICUUTTWPLA-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 37.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | 331 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.32 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |