C21H23FNO2+ — CID 7632509
[2-[(2-fluorophenyl)methoxy]naphthalen-1-yl]methyl-[(2R)-2-hydroxypropyl]azanium (PubChem CID 7632509) has the molecular formula C21H23FNO2+ and a molecular weight of 340.42 g/mol. Its IUPAC name is [2-[(2-fluorophenyl)methoxy]naphthalen-1-yl]methyl-[(2R)-2-hydroxypropyl]azanium.
| Compound Name | [2-[(2-fluorophenyl)methoxy]naphthalen-1-yl]methyl-[(2R)-2-hydroxypropyl]azanium |
|---|---|
| PubChem CID | 7632509 |
| Molecular Formula | C21H23FNO2+ |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.17 |
| IUPAC Name | [2-[(2-fluorophenyl)methoxy]naphthalen-1-yl]methyl-[(2R)-2-hydroxypropyl]azanium |
| SMILES | C[C@@H](O)C[NH2+]Cc1c(OCc2ccccc2F)ccc2ccccc12 |
| InChI | InChI=1S/C21H22FNO2/c1-15(24)12-23-13-19-18-8-4-2-6-16(18)10-11-21(19)25-14-17-7-3-5-9-20(17)22/h2-11,15,23-24H,12-14H2,1H3/p+1/t15-/m1/s1 |
| InChIKey | NJNLXENWMKKLLB-OAHLLOKOSA-O |
| XLogP | 3.00 |
| TPSA | 46.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |