C23H28N2O3 — CID 7636802
cyclohexyl 4-[[2-(2,4-dimethylanilino)-2-oxoethyl]amino]benzoate (PubChem CID 7636802) has the molecular formula C23H28N2O3 and a molecular weight of 380.49 g/mol. Its IUPAC name is cyclohexyl 4-[[2-(2,4-dimethylanilino)-2-oxoethyl]amino]benzoate.
| Compound Name | cyclohexyl 4-[[2-(2,4-dimethylanilino)-2-oxoethyl]amino]benzoate |
|---|---|
| PubChem CID | 7636802 |
| Molecular Formula | C23H28N2O3 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.21 |
| IUPAC Name | cyclohexyl 4-[[2-(2,4-dimethylanilino)-2-oxoethyl]amino]benzoate |
| SMILES | Cc1ccc(NC(=O)CNc2ccc(C(=O)OC3CCCCC3)cc2)c(C)c1 |
| InChI | InChI=1S/C23H28N2O3/c1-16-8-13-21(17(2)14-16)25-22(26)15-24-19-11-9-18(10-12-19)23(27)28-20-6-4-3-5-7-20/h8-14,20,24H,3-7,15H2,1-2H3,(H,25,26) |
| InChIKey | KYTOWMZHLRLYDI-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |