C18H16FN2O5S- — CID 7641785
(2S)-1-[2-[(5Z)-5-[(4-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]piperidine-2-carboxylate (PubChem CID 7641785) has the molecular formula C18H16FN2O5S- and a molecular weight of 391.40 g/mol. Its IUPAC name is (2S)-1-[2-[(5Z)-5-[(4-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]piperidine-2-carboxylate.
| Compound Name | (2S)-1-[2-[(5Z)-5-[(4-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]piperidine-2-carboxylate |
|---|---|
| PubChem CID | 7641785 |
| Molecular Formula | C18H16FN2O5S- |
| Molecular Weight | 391.40 g/mol |
| Exact Mass | 391.08 |
| IUPAC Name | (2S)-1-[2-[(5Z)-5-[(4-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]piperidine-2-carboxylate |
| SMILES | O=C([O-])[C@@H]1CCCCN1C(=O)CN1C(=O)S/C(=C\c2ccc(F)cc2)C1=O |
| InChI | InChI=1S/C18H17FN2O5S/c19-12-6-4-11(5-7-12)9-14-16(23)21(18(26)27-14)10-15(22)20-8-2-1-3-13(20)17(24)25/h4-7,9,13H,1-3,8,10H2,(H,24,25)/p-1/b14-9-/t13-/m0/s1 |
| InChIKey | AQJLPFIBXDQGAI-GFAPJHNFSA-M |
| XLogP | 0.99 |
| TPSA | 97.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.40 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|