C22H33N5O4 — CID 7645044
1-[2-[[(2R)-2-[4-(dimethylamino)phenyl]-2-morpholin-4-ylethyl]amino]-2-oxoacetyl]piperidine-4-carboxamide (PubChem CID 7645044) has the molecular formula C22H33N5O4 and a molecular weight of 431.54 g/mol. Its IUPAC name is 1-[2-[[(2R)-2-[4-(dimethylamino)phenyl]-2-morpholin-4-ylethyl]amino]-2-oxoacetyl]piperidine-4-carboxamide.
| Compound Name | 1-[2-[[(2R)-2-[4-(dimethylamino)phenyl]-2-morpholin-4-ylethyl]amino]-2-oxoacetyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 7645044 |
| Molecular Formula | C22H33N5O4 |
| Molecular Weight | 431.54 g/mol |
| Exact Mass | 431.25 |
| IUPAC Name | 1-[2-[[(2R)-2-[4-(dimethylamino)phenyl]-2-morpholin-4-ylethyl]amino]-2-oxoacetyl]piperidine-4-carboxamide |
| SMILES | CN(C)c1ccc([C@H](CNC(=O)C(=O)N2CCC(C(N)=O)CC2)N2CCOCC2)cc1 |
| InChI | InChI=1S/C22H33N5O4/c1-25(2)18-5-3-16(4-6-18)19(26-11-13-31-14-12-26)15-24-21(29)22(30)27-9-7-17(8-10-27)20(23)28/h3-6,17,19H,7-15H2,1-2H3,(H2,23,28)(H,24,29)/t19-/m0/s1 |
| InChIKey | SHYVXCWPQLYNAK-IBGZPJMESA-N |
| XLogP | -0.03 |
| TPSA | 108.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.54 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|