C19H20FNO4S — CID 7650921
[2-[(3-methoxyphenyl)methylamino]-2-oxoethyl] 3-(4-fluorophenyl)sulfanylpropanoate (PubChem CID 7650921) has the molecular formula C19H20FNO4S and a molecular weight of 377.44 g/mol. Its IUPAC name is [2-[(3-methoxyphenyl)methylamino]-2-oxoethyl] 3-(4-fluorophenyl)sulfanylpropanoate.
| Compound Name | [2-[(3-methoxyphenyl)methylamino]-2-oxoethyl] 3-(4-fluorophenyl)sulfanylpropanoate |
|---|---|
| PubChem CID | 7650921 |
| Molecular Formula | C19H20FNO4S |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.11 |
| IUPAC Name | [2-[(3-methoxyphenyl)methylamino]-2-oxoethyl] 3-(4-fluorophenyl)sulfanylpropanoate |
| SMILES | COc1cccc(CNC(=O)COC(=O)CCSc2ccc(F)cc2)c1 |
| InChI | InChI=1S/C19H20FNO4S/c1-24-16-4-2-3-14(11-16)12-21-18(22)13-25-19(23)9-10-26-17-7-5-15(20)6-8-17/h2-8,11H,9-10,12-13H2,1H3,(H,21,22) |
| InChIKey | DEMCDFCERNCWAO-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |