C40H58N4O4 — CID 76514062
4-[[2,6-bis[(4-methoxyphenyl)methyl]-10,10,12,12-tetramethyl-9-(morpholin-4-ylmethyl)-2,6-diazatetracyclo[5.3.1.15,8.03,9]dodecan-8-yl]methyl]morpholine (PubChem CID 76514062) has the molecular formula C40H58N4O4 and a molecular weight of 658.93 g/mol. Its IUPAC name is 4-[[2,6-bis[(4-methoxyphenyl)methyl]-10,10,12,12-tetramethyl-9-(morpholin-4-ylmethyl)-2,6-diazatetracyclo[5.3.1.15,8.03,9]dodecan-8-yl]methyl]morpholine.
| Compound Name | 4-[[2,6-bis[(4-methoxyphenyl)methyl]-10,10,12,12-tetramethyl-9-(morpholin-4-ylmethyl)-2,6-diazatetracyclo[5.3.1.15,8.03,9]dodecan-8-yl]methyl]morpholine |
|---|---|
| PubChem CID | 76514062 |
| Molecular Formula | C40H58N4O4 |
| Molecular Weight | 658.93 g/mol |
| Exact Mass | 658.45 |
| IUPAC Name | 4-[[2,6-bis[(4-methoxyphenyl)methyl]-10,10,12,12-tetramethyl-9-(morpholin-4-ylmethyl)-2,6-diazatetracyclo[5.3.1.15,8.03,9]dodecan-8-yl]methyl]morpholine |
| SMILES | COc1ccc(CN2C3CC4N(Cc5ccc(OC)cc5)C5CC2C(CN2CCOCC2)(C3(C)C)C4(CN2CCOCC2)C5(C)C)cc1 |
| InChI | InChI=1S/C40H58N4O4/c1-37(2)33-23-36-40(28-42-17-21-48-22-18-42)38(3,4)34(44(36)26-30-9-13-32(46-6)14-10-30)24-35(39(37,40)27-41-15-19-47-20-16-41)43(33)25-29-7-11-31(45-5)12-8-29/h7-14,33-36H,15-28H2,1-6H3 |
| InChIKey | PAVRXLWQRIVFGW-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 49.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.93 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |