C15H18O3 — CID 76518531
7-hydroxy-8a-methyl-3,5-dimethylidene-3a,6,7,8,9,9a-hexahydrobenzo[f][1]benzofuran-2-one (PubChem CID 76518531) has the molecular formula C15H18O3 and a molecular weight of 246.31 g/mol. Its IUPAC name is 7-hydroxy-8a-methyl-3,5-dimethylidene-3a,6,7,8,9,9a-hexahydrobenzo[f][1]benzofuran-2-one.
| Compound Name | 7-hydroxy-8a-methyl-3,5-dimethylidene-3a,6,7,8,9,9a-hexahydrobenzo[f][1]benzofuran-2-one |
|---|---|
| PubChem CID | 76518531 |
| Molecular Formula | C15H18O3 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.13 |
| IUPAC Name | 7-hydroxy-8a-methyl-3,5-dimethylidene-3a,6,7,8,9,9a-hexahydrobenzo[f][1]benzofuran-2-one |
| SMILES | C=C1CC(O)CC2(C)CC3OC(=O)C(=C)C3C=C12 |
| InChI | InChI=1S/C15H18O3/c1-8-4-10(16)6-15(3)7-13-11(5-12(8)15)9(2)14(17)18-13/h5,10-11,13,16H,1-2,4,6-7H2,3H3 |
| InChIKey | RTCBEIZCBZSCEH-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|