C23H19N3O3 — CID 76524976
3-(9-hydroxy-1-azatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraen-3-yl)-4-(1H-indol-3-yl)pyrrolidine-2,5-dione (PubChem CID 76524976) has the molecular formula C23H19N3O3 and a molecular weight of 385.42 g/mol. Its IUPAC name is 3-(9-hydroxy-1-azatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraen-3-yl)-4-(1H-indol-3-yl)pyrrolidine-2,5-dione.
| Compound Name | 3-(9-hydroxy-1-azatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraen-3-yl)-4-(1H-indol-3-yl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 76524976 |
| Molecular Formula | C23H19N3O3 |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.14 |
| IUPAC Name | 3-(9-hydroxy-1-azatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraen-3-yl)-4-(1H-indol-3-yl)pyrrolidine-2,5-dione |
| SMILES | O=C1NC(=O)C(c2cn3c4c(cccc24)C(O)CC3)C1c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C23H19N3O3/c27-18-8-9-26-11-16(13-5-3-6-14(18)21(13)26)20-19(22(28)25-23(20)29)15-10-24-17-7-2-1-4-12(15)17/h1-7,10-11,18-20,24,27H,8-9H2,(H,25,28,29) |
| InChIKey | KUJUSTBBOKWYSG-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 87.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|