C15H22O2 — CID 76525506
5-(hydroxymethyl)-1,3a,5-trimethyl-3b,4,6,6a,7,7a-hexahydrocyclopenta[a]pentalen-3-one (PubChem CID 76525506) has the molecular formula C15H22O2 and a molecular weight of 234.34 g/mol. Its IUPAC name is 5-(hydroxymethyl)-1,3a,5-trimethyl-3b,4,6,6a,7,7a-hexahydrocyclopenta[a]pentalen-3-one.
| Compound Name | 5-(hydroxymethyl)-1,3a,5-trimethyl-3b,4,6,6a,7,7a-hexahydrocyclopenta[a]pentalen-3-one |
|---|---|
| PubChem CID | 76525506 |
| Molecular Formula | C15H22O2 |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.16 |
| IUPAC Name | 5-(hydroxymethyl)-1,3a,5-trimethyl-3b,4,6,6a,7,7a-hexahydrocyclopenta[a]pentalen-3-one |
| SMILES | CC1=CC(=O)C2(C)C1CC1CC(C)(CO)CC12 |
| InChI | InChI=1S/C15H22O2/c1-9-4-13(17)15(3)11(9)5-10-6-14(2,8-16)7-12(10)15/h4,10-12,16H,5-8H2,1-3H3 |
| InChIKey | UVSPCYVKHYHCBU-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |