C22H25ClN2O3 — CID 7653013
(2S)-2-(2-chloro-4-phenylphenoxy)-N-(cyclohexylcarbamoyl)propanamide (PubChem CID 7653013) has the molecular formula C22H25ClN2O3 and a molecular weight of 400.91 g/mol. Its IUPAC name is (2S)-2-(2-chloro-4-phenylphenoxy)-N-(cyclohexylcarbamoyl)propanamide.
| Compound Name | (2S)-2-(2-chloro-4-phenylphenoxy)-N-(cyclohexylcarbamoyl)propanamide |
|---|---|
| PubChem CID | 7653013 |
| Molecular Formula | C22H25ClN2O3 |
| Molecular Weight | 400.91 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | (2S)-2-(2-chloro-4-phenylphenoxy)-N-(cyclohexylcarbamoyl)propanamide |
| SMILES | C[C@H](Oc1ccc(-c2ccccc2)cc1Cl)C(=O)NC(=O)NC1CCCCC1 |
| InChI | InChI=1S/C22H25ClN2O3/c1-15(21(26)25-22(27)24-18-10-6-3-7-11-18)28-20-13-12-17(14-19(20)23)16-8-4-2-5-9-16/h2,4-5,8-9,12-15,18H,3,6-7,10-11H2,1H3,(H2,24,25,26,27)/t15-/m0/s1 |
| InChIKey | QTBLUSWFKSFTAY-HNNXBMFYSA-N |
| XLogP | 4.93 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.91 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |