C21H15ClF3NO2 — CID 7653031
(2S)-2-(2-chloro-4-phenylphenoxy)-N-(2,3,4-trifluorophenyl)propanamide (PubChem CID 7653031) has the molecular formula C21H15ClF3NO2 and a molecular weight of 405.80 g/mol. Its IUPAC name is (2S)-2-(2-chloro-4-phenylphenoxy)-N-(2,3,4-trifluorophenyl)propanamide.
| Compound Name | (2S)-2-(2-chloro-4-phenylphenoxy)-N-(2,3,4-trifluorophenyl)propanamide |
|---|---|
| PubChem CID | 7653031 |
| Molecular Formula | C21H15ClF3NO2 |
| Molecular Weight | 405.80 g/mol |
| Exact Mass | 405.07 |
| IUPAC Name | (2S)-2-(2-chloro-4-phenylphenoxy)-N-(2,3,4-trifluorophenyl)propanamide |
| SMILES | C[C@H](Oc1ccc(-c2ccccc2)cc1Cl)C(=O)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C21H15ClF3NO2/c1-12(21(27)26-17-9-8-16(23)19(24)20(17)25)28-18-10-7-14(11-15(18)22)13-5-3-2-4-6-13/h2-12H,1H3,(H,26,27)/t12-/m0/s1 |
| InChIKey | HODPMQRESDWOIJ-LBPRGKRZSA-N |
| XLogP | 5.83 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.80 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|