C18H13Cl2F6N3O3 — CID 76530344
5-(3,4-dichlorophenyl)-6-(2,2,2-trifluoroethoxy)-N-(3,3,3-trifluoro-2-methoxyiminopropyl)pyridine-3-carboxamide (PubChem CID 76530344) has the molecular formula C18H13Cl2F6N3O3 and a molecular weight of 504.21 g/mol. Its IUPAC name is 5-(3,4-dichlorophenyl)-6-(2,2,2-trifluoroethoxy)-N-(3,3,3-trifluoro-2-methoxyiminopropyl)pyridine-3-carboxamide.
| Compound Name | 5-(3,4-dichlorophenyl)-6-(2,2,2-trifluoroethoxy)-N-(3,3,3-trifluoro-2-methoxyiminopropyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 76530344 |
| Molecular Formula | C18H13Cl2F6N3O3 |
| Molecular Weight | 504.21 g/mol |
| Exact Mass | 503.02 |
| IUPAC Name | 5-(3,4-dichlorophenyl)-6-(2,2,2-trifluoroethoxy)-N-(3,3,3-trifluoro-2-methoxyiminopropyl)pyridine-3-carboxamide |
| SMILES | CON=C(CNC(=O)c1cnc(OCC(F)(F)F)c(-c2ccc(Cl)c(Cl)c2)c1)C(F)(F)F |
| InChI | InChI=1S/C18H13Cl2F6N3O3/c1-31-29-14(18(24,25)26)7-27-15(30)10-4-11(9-2-3-12(19)13(20)5-9)16(28-6-10)32-8-17(21,22)23/h2-6H,7-8H2,1H3,(H,27,30) |
| InChIKey | NEELUFIBZDNGKI-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 72.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.21 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|