C24H34N2O2 — CID 76533725
(17-imidazol-1-yl-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-6-yl) acetate (PubChem CID 76533725) has the molecular formula C24H34N2O2 and a molecular weight of 382.55 g/mol. Its IUPAC name is (17-imidazol-1-yl-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-6-yl) acetate.
| Compound Name | (17-imidazol-1-yl-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-6-yl) acetate |
|---|---|
| PubChem CID | 76533725 |
| Molecular Formula | C24H34N2O2 |
| Molecular Weight | 382.55 g/mol |
| Exact Mass | 382.26 |
| IUPAC Name | (17-imidazol-1-yl-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-6-yl) acetate |
| SMILES | CC(=O)OC1CC2C3CC=C(n4ccnc4)C3(C)CCC2C2(C)CCCCC12 |
| InChI | InChI=1S/C24H34N2O2/c1-16(27)28-21-14-17-18-7-8-22(26-13-12-25-15-26)24(18,3)11-9-19(17)23(2)10-5-4-6-20(21)23/h8,12-13,15,17-21H,4-7,9-11,14H2,1-3H3 |
| InChIKey | ZOXIAOVHIVBXFH-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.55 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |