C30H41FN2O2 — CID 76556836
1-(3,5-ditert-butyl-4-hydroxyphenyl)-2-[3-[(4-fluorophenyl)methyl]-2-imino-4-propylpyrrolidin-1-yl]ethanone (PubChem CID 76556836) has the molecular formula C30H41FN2O2 and a molecular weight of 480.67 g/mol. Its IUPAC name is 1-(3,5-ditert-butyl-4-hydroxyphenyl)-2-[3-[(4-fluorophenyl)methyl]-2-imino-4-propylpyrrolidin-1-yl]ethanone.
| Compound Name | 1-(3,5-ditert-butyl-4-hydroxyphenyl)-2-[3-[(4-fluorophenyl)methyl]-2-imino-4-propylpyrrolidin-1-yl]ethanone |
|---|---|
| PubChem CID | 76556836 |
| Molecular Formula | C30H41FN2O2 |
| Molecular Weight | 480.67 g/mol |
| Exact Mass | 480.32 |
| IUPAC Name | 1-(3,5-ditert-butyl-4-hydroxyphenyl)-2-[3-[(4-fluorophenyl)methyl]-2-imino-4-propylpyrrolidin-1-yl]ethanone |
| SMILES | [H]/N=C1\C(Cc2ccc(F)cc2)C(CCC)CN1CC(=O)c1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C30H41FN2O2/c1-8-9-20-17-33(28(32)23(20)14-19-10-12-22(31)13-11-19)18-26(34)21-15-24(29(2,3)4)27(35)25(16-21)30(5,6)7/h10-13,15-16,20,23,32,35H,8-9,14,17-18H2,1-7H3/b32-28+ |
| InChIKey | NMOLRBZAXMKGJG-VEWQFJOQSA-N |
| XLogP | 6.88 |
| TPSA | 64.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.67 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|