C14H14N2O2 — CID 7655966
N-(4-cyano-2,3-dihydrofuran-5-yl)-2,5-dimethylbenzamide (PubChem CID 7655966) has the molecular formula C14H14N2O2 and a molecular weight of 242.28 g/mol. Its IUPAC name is N-(4-cyano-2,3-dihydrofuran-5-yl)-2,5-dimethylbenzamide.
| Compound Name | N-(4-cyano-2,3-dihydrofuran-5-yl)-2,5-dimethylbenzamide |
|---|---|
| PubChem CID | 7655966 |
| Molecular Formula | C14H14N2O2 |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | N-(4-cyano-2,3-dihydrofuran-5-yl)-2,5-dimethylbenzamide |
| SMILES | Cc1ccc(C)c(C(=O)NC2=C(C#N)CCO2)c1 |
| InChI | InChI=1S/C14H14N2O2/c1-9-3-4-10(2)12(7-9)13(17)16-14-11(8-15)5-6-18-14/h3-4,7H,5-6H2,1-2H3,(H,16,17) |
| InChIKey | FPNVBEYTOTXEBL-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |