C37H43N2S+ — CID 76559797
1,3,3-trimethyl-2-[2-[2-thiopyran-1-yl-3-[2-(1,3,3-trimethylindol-1-ium-2-yl)ethyl]cyclohex-2-en-1-ylidene]ethylidene]indole (PubChem CID 76559797) has the molecular formula C37H43N2S+ and a molecular weight of 547.83 g/mol. Its IUPAC name is 1,3,3-trimethyl-2-[2-[2-thiopyran-1-yl-3-[2-(1,3,3-trimethylindol-1-ium-2-yl)ethyl]cyclohex-2-en-1-ylidene]ethylidene]indole.
| Compound Name | 1,3,3-trimethyl-2-[2-[2-thiopyran-1-yl-3-[2-(1,3,3-trimethylindol-1-ium-2-yl)ethyl]cyclohex-2-en-1-ylidene]ethylidene]indole |
|---|---|
| PubChem CID | 76559797 |
| Molecular Formula | C37H43N2S+ |
| Molecular Weight | 547.83 g/mol |
| Exact Mass | 547.31 |
| IUPAC Name | 1,3,3-trimethyl-2-[2-[2-thiopyran-1-yl-3-[2-(1,3,3-trimethylindol-1-ium-2-yl)ethyl]cyclohex-2-en-1-ylidene]ethylidene]indole |
| SMILES | CN1C(=CC=C2CCCC(CCC3=[N+](C)c4ccccc4C3(C)C)=C2S2=CC=CC=C2)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C37H43N2S/c1-36(2)29-17-8-10-19-31(29)38(5)33(36)23-21-27-15-14-16-28(35(27)40-25-12-7-13-26-40)22-24-34-37(3,4)30-18-9-11-20-32(30)39(34)6/h7-13,17-21,23,25-26H,14-16,22,24H2,1-6H3/q+1 |
| InChIKey | LONVDCCIYVNVMR-UHFFFAOYSA-N |
| XLogP | 9.30 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.83 |
| LogP ≤ 5 | 9.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|