C17H18NO3S2- — CID 7656162
(2S,3S)-3-methyl-2-[(5Z)-5-[(3-methylphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]pentanoate (PubChem CID 7656162) has the molecular formula C17H18NO3S2- and a molecular weight of 348.47 g/mol. Its IUPAC name is (2S,3S)-3-methyl-2-[(5Z)-5-[(3-methylphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]pentanoate.
| Compound Name | (2S,3S)-3-methyl-2-[(5Z)-5-[(3-methylphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]pentanoate |
|---|---|
| PubChem CID | 7656162 |
| Molecular Formula | C17H18NO3S2- |
| Molecular Weight | 348.47 g/mol |
| Exact Mass | 348.07 |
| IUPAC Name | (2S,3S)-3-methyl-2-[(5Z)-5-[(3-methylphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]pentanoate |
| SMILES | CC[C@H](C)[C@@H](C(=O)[O-])N1C(=O)/C(=C/c2cccc(C)c2)SC1=S |
| InChI | InChI=1S/C17H19NO3S2/c1-4-11(3)14(16(20)21)18-15(19)13(23-17(18)22)9-12-7-5-6-10(2)8-12/h5-9,11,14H,4H2,1-3H3,(H,20,21)/p-1/b13-9-/t11-,14-/m0/s1 |
| InChIKey | FARBAWLPXWCQJK-DPUHMWKMSA-M |
| XLogP | 2.36 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.47 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|