C18H20NO3S2- — CID 7656209
(2R,3S)-2-[(5Z)-5-[(4-ethylphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-methylpentanoate (PubChem CID 7656209) has the molecular formula C18H20NO3S2- and a molecular weight of 362.50 g/mol. Its IUPAC name is (2R,3S)-2-[(5Z)-5-[(4-ethylphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-methylpentanoate.
| Compound Name | (2R,3S)-2-[(5Z)-5-[(4-ethylphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-methylpentanoate |
|---|---|
| PubChem CID | 7656209 |
| Molecular Formula | C18H20NO3S2- |
| Molecular Weight | 362.50 g/mol |
| Exact Mass | 362.09 |
| IUPAC Name | (2R,3S)-2-[(5Z)-5-[(4-ethylphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-methylpentanoate |
| SMILES | CCc1ccc(/C=C2\SC(=S)N([C@@H](C(=O)[O-])[C@@H](C)CC)C2=O)cc1 |
| InChI | InChI=1S/C18H21NO3S2/c1-4-11(3)15(17(21)22)19-16(20)14(24-18(19)23)10-13-8-6-12(5-2)7-9-13/h6-11,15H,4-5H2,1-3H3,(H,21,22)/p-1/b14-10-/t11-,15+/m0/s1 |
| InChIKey | DJXWJJHUBZCVJX-WKVAABHYSA-M |
| XLogP | 2.61 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.50 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|