C33H26ClF3N2O5S2 — CID 76562897
[[4-(4-chlorophenyl)sulfanyl-1-[9-ethyl-6-(2-methylbenzoyl)carbazol-3-yl]-1-oxobutan-2-ylidene]amino] trifluoromethanesulfonate (PubChem CID 76562897) has the molecular formula C33H26ClF3N2O5S2 and a molecular weight of 687.16 g/mol. Its IUPAC name is [[4-(4-chlorophenyl)sulfanyl-1-[9-ethyl-6-(2-methylbenzoyl)carbazol-3-yl]-1-oxobutan-2-ylidene]amino] trifluoromethanesulfonate.
| Compound Name | [[4-(4-chlorophenyl)sulfanyl-1-[9-ethyl-6-(2-methylbenzoyl)carbazol-3-yl]-1-oxobutan-2-ylidene]amino] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 76562897 |
| Molecular Formula | C33H26ClF3N2O5S2 |
| Molecular Weight | 687.16 g/mol |
| Exact Mass | 686.09 |
| IUPAC Name | [[4-(4-chlorophenyl)sulfanyl-1-[9-ethyl-6-(2-methylbenzoyl)carbazol-3-yl]-1-oxobutan-2-ylidene]amino] trifluoromethanesulfonate |
| SMILES | CCn1c2ccc(C(=O)C(CCSc3ccc(Cl)cc3)=NOS(=O)(=O)C(F)(F)F)cc2c2cc(C(=O)c3ccccc3C)ccc21 |
| InChI | InChI=1S/C33H26ClF3N2O5S2/c1-3-39-29-14-8-21(31(40)25-7-5-4-6-20(25)2)18-26(29)27-19-22(9-15-30(27)39)32(41)28(38-44-46(42,43)33(35,36)37)16-17-45-24-12-10-23(34)11-13-24/h4-15,18-19H,3,16-17H2,1-2H3 |
| InChIKey | GLMGOCAQQPNVNV-UHFFFAOYSA-N |
| XLogP | 8.59 |
| TPSA | 94.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.16 |
| LogP ≤ 5 | 8.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|