C14H24Si2 — CID 76569435
(3,4-dimethyl-6-trimethylsilylhex-3-en-1,5-diynyl)-trimethylsilane (PubChem CID 76569435) has the molecular formula C14H24Si2 and a molecular weight of 248.52 g/mol. Its IUPAC name is (3,4-dimethyl-6-trimethylsilylhex-3-en-1,5-diynyl)-trimethylsilane.
| Compound Name | (3,4-dimethyl-6-trimethylsilylhex-3-en-1,5-diynyl)-trimethylsilane |
|---|---|
| PubChem CID | 76569435 |
| Molecular Formula | C14H24Si2 |
| Molecular Weight | 248.52 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | (3,4-dimethyl-6-trimethylsilylhex-3-en-1,5-diynyl)-trimethylsilane |
| SMILES | CC(C#C[Si](C)(C)C)=C(C)C#C[Si](C)(C)C |
| InChI | InChI=1S/C14H24Si2/c1-13(9-11-15(3,4)5)14(2)10-12-16(6,7)8/h1-8H3 |
| InChIKey | MTQIWBFWQZJZCU-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.52 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|