C24H24ClNO6 — CID 76577560
ethyl 4-[4-chloro-2-(2,3-dimethoxybenzoyl)-N-prop-2-enylanilino]-4-oxobut-2-enoate (PubChem CID 76577560) has the molecular formula C24H24ClNO6 and a molecular weight of 457.91 g/mol. Its IUPAC name is ethyl 4-[4-chloro-2-(2,3-dimethoxybenzoyl)-N-prop-2-enylanilino]-4-oxobut-2-enoate.
| Compound Name | ethyl 4-[4-chloro-2-(2,3-dimethoxybenzoyl)-N-prop-2-enylanilino]-4-oxobut-2-enoate |
|---|---|
| PubChem CID | 76577560 |
| Molecular Formula | C24H24ClNO6 |
| Molecular Weight | 457.91 g/mol |
| Exact Mass | 457.13 |
| IUPAC Name | ethyl 4-[4-chloro-2-(2,3-dimethoxybenzoyl)-N-prop-2-enylanilino]-4-oxobut-2-enoate |
| SMILES | C=CCN(C(=O)C=CC(=O)OCC)c1ccc(Cl)cc1C(=O)c1cccc(OC)c1OC |
| InChI | InChI=1S/C24H24ClNO6/c1-5-14-26(21(27)12-13-22(28)32-6-2)19-11-10-16(25)15-18(19)23(29)17-8-7-9-20(30-3)24(17)31-4/h5,7-13,15H,1,6,14H2,2-4H3 |
| InChIKey | GXKYDELSZKVYEK-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.91 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|