C20H17IN2OS — CID 76581944
6-iodo-2-methyl-1-phenyl-N-(1,3-thiazol-2-yl)-1,3-dihydroindene-2-carboxamide (PubChem CID 76581944) has the molecular formula C20H17IN2OS and a molecular weight of 460.34 g/mol. Its IUPAC name is 6-iodo-2-methyl-1-phenyl-N-(1,3-thiazol-2-yl)-1,3-dihydroindene-2-carboxamide.
| Compound Name | 6-iodo-2-methyl-1-phenyl-N-(1,3-thiazol-2-yl)-1,3-dihydroindene-2-carboxamide |
|---|---|
| PubChem CID | 76581944 |
| Molecular Formula | C20H17IN2OS |
| Molecular Weight | 460.34 g/mol |
| Exact Mass | 460.01 |
| IUPAC Name | 6-iodo-2-methyl-1-phenyl-N-(1,3-thiazol-2-yl)-1,3-dihydroindene-2-carboxamide |
| SMILES | CC1(C(=O)Nc2nccs2)Cc2ccc(I)cc2C1c1ccccc1 |
| InChI | InChI=1S/C20H17IN2OS/c1-20(18(24)23-19-22-9-10-25-19)12-14-7-8-15(21)11-16(14)17(20)13-5-3-2-4-6-13/h2-11,17H,12H2,1H3,(H,22,23,24) |
| InChIKey | JEFYKVRJWJYJNZ-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.34 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|