C22H24N2O3S — CID 143493995
(1R,2S)-5,6-dimethoxy-2-methyl-1-phenyl-N-(1,3-thiazol-2-yl)-1,3,3a,4-tetrahydroindene-2-carboxamide (PubChem CID 143493995) has the molecular formula C22H24N2O3S and a molecular weight of 396.51 g/mol. Its IUPAC name is (1R,2S)-5,6-dimethoxy-2-methyl-1-phenyl-N-(1,3-thiazol-2-yl)-1,3,3a,4-tetrahydroindene-2-carboxamide.
| Compound Name | (1R,2S)-5,6-dimethoxy-2-methyl-1-phenyl-N-(1,3-thiazol-2-yl)-1,3,3a,4-tetrahydroindene-2-carboxamide |
|---|---|
| PubChem CID | 143493995 |
| Molecular Formula | C22H24N2O3S |
| Molecular Weight | 396.51 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | (1R,2S)-5,6-dimethoxy-2-methyl-1-phenyl-N-(1,3-thiazol-2-yl)-1,3,3a,4-tetrahydroindene-2-carboxamide |
| SMILES | COC1=C(OC)CC2C[C@](C)(C(=O)Nc3nccs3)[C@H](c3ccccc3)C2=C1 |
| InChI | InChI=1S/C22H24N2O3S/c1-22(20(25)24-21-23-9-10-28-21)13-15-11-17(26-2)18(27-3)12-16(15)19(22)14-7-5-4-6-8-14/h4-10,12,15,19H,11,13H2,1-3H3,(H,23,24,25)/t15?,19-,22+/m1/s1 |
| InChIKey | YODAXKZNAFXUDZ-IBWUSFKPSA-N |
| XLogP | 4.73 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.51 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |