C24H27Cl2N5O3 — CID 76586687
1-[2-[4-[2-chloro-4-(2-hydroxyethoxy)phenyl]-3-(4-chlorophenyl)piperazin-1-yl]ethyl]imidazole-4-carboxamide (PubChem CID 76586687) has the molecular formula C24H27Cl2N5O3 and a molecular weight of 504.42 g/mol. Its IUPAC name is 1-[2-[4-[2-chloro-4-(2-hydroxyethoxy)phenyl]-3-(4-chlorophenyl)piperazin-1-yl]ethyl]imidazole-4-carboxamide.
| Compound Name | 1-[2-[4-[2-chloro-4-(2-hydroxyethoxy)phenyl]-3-(4-chlorophenyl)piperazin-1-yl]ethyl]imidazole-4-carboxamide |
|---|---|
| PubChem CID | 76586687 |
| Molecular Formula | C24H27Cl2N5O3 |
| Molecular Weight | 504.42 g/mol |
| Exact Mass | 503.15 |
| IUPAC Name | 1-[2-[4-[2-chloro-4-(2-hydroxyethoxy)phenyl]-3-(4-chlorophenyl)piperazin-1-yl]ethyl]imidazole-4-carboxamide |
| SMILES | NC(=O)c1cn(CCN2CCN(c3ccc(OCCO)cc3Cl)C(c3ccc(Cl)cc3)C2)cn1 |
| InChI | InChI=1S/C24H27Cl2N5O3/c25-18-3-1-17(2-4-18)23-15-29(7-8-30-14-21(24(27)33)28-16-30)9-10-31(23)22-6-5-19(13-20(22)26)34-12-11-32/h1-6,13-14,16,23,32H,7-12,15H2,(H2,27,33) |
| InChIKey | LYKRPBPENHGRNR-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 96.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.42 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|