C22H21N3O — CID 76587033
2-amino-3-phenyl-1-(5-pyridin-4-yl-2,3-dihydroindol-1-yl)propan-1-one (PubChem CID 76587033) has the molecular formula C22H21N3O and a molecular weight of 343.43 g/mol. Its IUPAC name is 2-amino-3-phenyl-1-(5-pyridin-4-yl-2,3-dihydroindol-1-yl)propan-1-one.
| Compound Name | 2-amino-3-phenyl-1-(5-pyridin-4-yl-2,3-dihydroindol-1-yl)propan-1-one |
|---|---|
| PubChem CID | 76587033 |
| Molecular Formula | C22H21N3O |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.17 |
| IUPAC Name | 2-amino-3-phenyl-1-(5-pyridin-4-yl-2,3-dihydroindol-1-yl)propan-1-one |
| SMILES | NC(Cc1ccccc1)C(=O)N1CCc2cc(-c3ccncc3)ccc21 |
| InChI | InChI=1S/C22H21N3O/c23-20(14-16-4-2-1-3-5-16)22(26)25-13-10-19-15-18(6-7-21(19)25)17-8-11-24-12-9-17/h1-9,11-12,15,20H,10,13-14,23H2 |
| InChIKey | OTQCXVKVIYVTOI-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |