C17H14Cl2F2N4OS — CID 76593077
3-[2-[chloro(difluoro)methyl]-6-(2-chlorophenyl)imidazo[2,1-b][1,3,4]thiadiazol-5-yl]-N-propan-2-ylprop-2-enamide (PubChem CID 76593077) has the molecular formula C17H14Cl2F2N4OS and a molecular weight of 431.30 g/mol. Its IUPAC name is 3-[2-[chloro(difluoro)methyl]-6-(2-chlorophenyl)imidazo[2,1-b][1,3,4]thiadiazol-5-yl]-N-propan-2-ylprop-2-enamide.
| Compound Name | 3-[2-[chloro(difluoro)methyl]-6-(2-chlorophenyl)imidazo[2,1-b][1,3,4]thiadiazol-5-yl]-N-propan-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 76593077 |
| Molecular Formula | C17H14Cl2F2N4OS |
| Molecular Weight | 431.30 g/mol |
| Exact Mass | 430.02 |
| IUPAC Name | 3-[2-[chloro(difluoro)methyl]-6-(2-chlorophenyl)imidazo[2,1-b][1,3,4]thiadiazol-5-yl]-N-propan-2-ylprop-2-enamide |
| SMILES | CC(C)NC(=O)C=Cc1c(-c2ccccc2Cl)nc2sc(C(F)(F)Cl)nn12 |
| InChI | InChI=1S/C17H14Cl2F2N4OS/c1-9(2)22-13(26)8-7-12-14(10-5-3-4-6-11(10)18)23-16-25(12)24-15(27-16)17(19,20)21/h3-9H,1-2H3,(H,22,26) |
| InChIKey | SYCRBUAETLEZNN-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 59.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.30 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|