C15H14ClNO2S — CID 82433893
(E)-3-[2-(2-chlorophenyl)-4-propan-2-yl-1,3-thiazol-5-yl]prop-2-enoic acid (PubChem CID 82433893) has the molecular formula C15H14ClNO2S and a molecular weight of 307.80 g/mol. Its IUPAC name is (E)-3-[2-(2-chlorophenyl)-4-propan-2-yl-1,3-thiazol-5-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[2-(2-chlorophenyl)-4-propan-2-yl-1,3-thiazol-5-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 82433893 |
| Molecular Formula | C15H14ClNO2S |
| Molecular Weight | 307.80 g/mol |
| Exact Mass | 307.04 |
| IUPAC Name | (E)-3-[2-(2-chlorophenyl)-4-propan-2-yl-1,3-thiazol-5-yl]prop-2-enoic acid |
| SMILES | CC(C)c1nc(-c2ccccc2Cl)sc1/C=C/C(=O)O |
| InChI | InChI=1S/C15H14ClNO2S/c1-9(2)14-12(7-8-13(18)19)20-15(17-14)10-5-3-4-6-11(10)16/h3-9H,1-2H3,(H,18,19)/b8-7+ |
| InChIKey | KIBQGMFFFYHHEV-BQYQJAHWSA-N |
| XLogP | 4.68 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.80 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|