C13H20N2O2S — CID 82435587
(E)-3-[2-(diethylamino)-4-propan-2-yl-1,3-thiazol-5-yl]prop-2-enoic acid (PubChem CID 82435587) has the molecular formula C13H20N2O2S and a molecular weight of 268.38 g/mol. Its IUPAC name is (E)-3-[2-(diethylamino)-4-propan-2-yl-1,3-thiazol-5-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[2-(diethylamino)-4-propan-2-yl-1,3-thiazol-5-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 82435587 |
| Molecular Formula | C13H20N2O2S |
| Molecular Weight | 268.38 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | (E)-3-[2-(diethylamino)-4-propan-2-yl-1,3-thiazol-5-yl]prop-2-enoic acid |
| SMILES | CCN(CC)c1nc(C(C)C)c(/C=C/C(=O)O)s1 |
| InChI | InChI=1S/C13H20N2O2S/c1-5-15(6-2)13-14-12(9(3)4)10(18-13)7-8-11(16)17/h7-9H,5-6H2,1-4H3,(H,16,17)/b8-7+ |
| InChIKey | ASSRLSGRHGWIAU-BQYQJAHWSA-N |
| XLogP | 3.21 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.38 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|