C13H14ClN3S — CID 82433886
2-(2-chlorophenyl)-4-propan-2-yl-1,3-thiazole-5-carboximidamide (PubChem CID 82433886) has the molecular formula C13H14ClN3S and a molecular weight of 279.80 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-4-propan-2-yl-1,3-thiazole-5-carboximidamide.
| Compound Name | 2-(2-chlorophenyl)-4-propan-2-yl-1,3-thiazole-5-carboximidamide |
|---|---|
| PubChem CID | 82433886 |
| Molecular Formula | C13H14ClN3S |
| Molecular Weight | 279.80 g/mol |
| Exact Mass | 279.06 |
| IUPAC Name | 2-(2-chlorophenyl)-4-propan-2-yl-1,3-thiazole-5-carboximidamide |
| SMILES | [H]/N=C(\N)c1sc(-c2ccccc2Cl)nc1C(C)C |
| InChI | InChI=1S/C13H14ClN3S/c1-7(2)10-11(12(15)16)18-13(17-10)8-5-3-4-6-9(8)14/h3-7H,1-2H3,(H3,15,16) |
| InChIKey | WTVCAYMUBVTPCE-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 62.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.80 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|