C27H40N2O5 — CID 76593976
2-amino-6-[[4-(3,7-dimethylnona-1,3,5,7-tetraenyl)-3,5,5-trimethyl-2-oxocyclohex-3-en-1-yl]oxycarbonylamino]hexanoic acid (PubChem CID 76593976) has the molecular formula C27H40N2O5 and a molecular weight of 472.63 g/mol. Its IUPAC name is 2-amino-6-[[4-(3,7-dimethylnona-1,3,5,7-tetraenyl)-3,5,5-trimethyl-2-oxocyclohex-3-en-1-yl]oxycarbonylamino]hexanoic acid.
| Compound Name | 2-amino-6-[[4-(3,7-dimethylnona-1,3,5,7-tetraenyl)-3,5,5-trimethyl-2-oxocyclohex-3-en-1-yl]oxycarbonylamino]hexanoic acid |
|---|---|
| PubChem CID | 76593976 |
| Molecular Formula | C27H40N2O5 |
| Molecular Weight | 472.63 g/mol |
| Exact Mass | 472.29 |
| IUPAC Name | 2-amino-6-[[4-(3,7-dimethylnona-1,3,5,7-tetraenyl)-3,5,5-trimethyl-2-oxocyclohex-3-en-1-yl]oxycarbonylamino]hexanoic acid |
| SMILES | CC=C(C)C=CC=C(C)C=CC1=C(C)C(=O)C(OC(=O)NCCCCC(N)C(=O)O)CC1(C)C |
| InChI | InChI=1S/C27H40N2O5/c1-7-18(2)11-10-12-19(3)14-15-21-20(4)24(30)23(17-27(21,5)6)34-26(33)29-16-9-8-13-22(28)25(31)32/h7,10-12,14-15,22-23H,8-9,13,16-17,28H2,1-6H3,(H,29,33)(H,31,32) |
| InChIKey | GARFWZYBIGHXBM-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 118.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.63 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|